C25H21ClN2O2 — CID 126135724
2-[[(E)-3-(2-chlorophenyl)-2-phenylprop-2-enoyl]amino]-N-prop-2-enylbenzamide (PubChem CID 126135724) has the molecular formula C25H21ClN2O2 and a molecular weight of 416.91 g/mol. Its IUPAC name is 2-[[(E)-3-(2-chlorophenyl)-2-phenylprop-2-enoyl]amino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[[(E)-3-(2-chlorophenyl)-2-phenylprop-2-enoyl]amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 126135724 |
| Molecular Formula | C25H21ClN2O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[[(E)-3-(2-chlorophenyl)-2-phenylprop-2-enoyl]amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)/C(=C/c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C25H21ClN2O2/c1-2-16-27-24(29)20-13-7-9-15-23(20)28-25(30)21(18-10-4-3-5-11-18)17-19-12-6-8-14-22(19)26/h2-15,17H,1,16H2,(H,27,29)(H,28,30)/b21-17+ |
| InChIKey | GLXQKXNYRCRMQE-HEHNFIMWSA-N |
| XLogP | 5.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|