C23H20ClNO — CID 2915971
3-(2-chlorophenyl)-N-(2,5-dimethylphenyl)-2-phenylprop-2-enamide (PubChem CID 2915971) has the molecular formula C23H20ClNO and a molecular weight of 361.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(2,5-dimethylphenyl)-2-phenylprop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-(2,5-dimethylphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 2915971 |
| Molecular Formula | C23H20ClNO |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(2,5-dimethylphenyl)-2-phenylprop-2-enamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(=Cc2ccccc2Cl)c2ccccc2)c1 |
| InChI | InChI=1S/C23H20ClNO/c1-16-12-13-17(2)22(14-16)25-23(26)20(18-8-4-3-5-9-18)15-19-10-6-7-11-21(19)24/h3-15H,1-2H3,(H,25,26) |
| InChIKey | XXJMGUIEQGOIHI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|