C29H24ClNO — CID 38020071
(E)-3-(2-chlorophenyl)-N-[(S)-(4-methylphenyl)-phenylmethyl]-2-phenylprop-2-enamide (PubChem CID 38020071) has the molecular formula C29H24ClNO and a molecular weight of 437.97 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[(S)-(4-methylphenyl)-phenylmethyl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[(S)-(4-methylphenyl)-phenylmethyl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 38020071 |
| Molecular Formula | C29H24ClNO |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[(S)-(4-methylphenyl)-phenylmethyl]-2-phenylprop-2-enamide |
| SMILES | Cc1ccc([C@@H](NC(=O)/C(=C/c2ccccc2Cl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24ClNO/c1-21-16-18-24(19-17-21)28(23-12-6-3-7-13-23)31-29(32)26(22-10-4-2-5-11-22)20-25-14-8-9-15-27(25)30/h2-20,28H,1H3,(H,31,32)/b26-20+/t28-/m0/s1 |
| InChIKey | CTORWBGLZSSAKN-NIJSQZSCSA-N |
| XLogP | 7.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|