C28H28ClNO — CID 133191082
(E)-3-(2-chlorophenyl)-2-phenyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide (PubChem CID 133191082) has the molecular formula C28H28ClNO and a molecular weight of 429.99 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-2-phenyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-2-phenyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 133191082 |
| Molecular Formula | C28H28ClNO |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-2-phenyl-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide |
| SMILES | CCC(NC(=O)/C(=C/c1ccccc1Cl)c1ccccc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C28H28ClNO/c1-2-27(24-17-16-20-10-6-7-13-22(20)18-24)30-28(31)25(21-11-4-3-5-12-21)19-23-14-8-9-15-26(23)29/h3-5,8-9,11-12,14-19,27H,2,6-7,10,13H2,1H3,(H,30,31)/b25-19+ |
| InChIKey | HTPSMMBSQMNCLP-NCELDCMTSA-N |
| XLogP | 7.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|