C25H24ClNO2 — CID 38015442
(E)-3-(2-chlorophenyl)-N-[(1R)-1-(4-ethoxyphenyl)ethyl]-2-phenylprop-2-enamide (PubChem CID 38015442) has the molecular formula C25H24ClNO2 and a molecular weight of 405.93 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[(1R)-1-(4-ethoxyphenyl)ethyl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[(1R)-1-(4-ethoxyphenyl)ethyl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 38015442 |
| Molecular Formula | C25H24ClNO2 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[(1R)-1-(4-ethoxyphenyl)ethyl]-2-phenylprop-2-enamide |
| SMILES | CCOc1ccc([C@@H](C)NC(=O)/C(=C/c2ccccc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24ClNO2/c1-3-29-22-15-13-19(14-16-22)18(2)27-25(28)23(20-9-5-4-6-10-20)17-21-11-7-8-12-24(21)26/h4-18H,3H2,1-2H3,(H,27,28)/b23-17+/t18-/m1/s1 |
| InChIKey | TUQZBGCLKUBLBA-KIJZHVTOSA-N |
| XLogP | 6.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|