C22H18ClNO2 — CID 1334364
(E)-3-(2-chlorophenyl)-N-(4-methoxyphenyl)-2-phenylprop-2-enamide (PubChem CID 1334364) has the molecular formula C22H18ClNO2 and a molecular weight of 363.84 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(4-methoxyphenyl)-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(4-methoxyphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 1334364 |
| Molecular Formula | C22H18ClNO2 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(4-methoxyphenyl)-2-phenylprop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(=C/c2ccccc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18ClNO2/c1-26-19-13-11-18(12-14-19)24-22(25)20(16-7-3-2-4-8-16)15-17-9-5-6-10-21(17)23/h2-15H,1H3,(H,24,25)/b20-15+ |
| InChIKey | HKYBAFQQQPVYJI-HMMYKYKNSA-N |
| XLogP | 5.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|