C26H25ClN2O3S — CID 6518487
(E)-3-(2-chlorophenyl)-2-phenyl-N-(4-piperidin-1-ylsulfonylphenyl)prop-2-enamide (PubChem CID 6518487) has the molecular formula C26H25ClN2O3S and a molecular weight of 481.02 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-2-phenyl-N-(4-piperidin-1-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-2-phenyl-N-(4-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6518487 |
| Molecular Formula | C26H25ClN2O3S |
| Molecular Weight | 481.02 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-2-phenyl-N-(4-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCCC2)cc1)/C(=C/c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C26H25ClN2O3S/c27-25-12-6-5-11-21(25)19-24(20-9-3-1-4-10-20)26(30)28-22-13-15-23(16-14-22)33(31,32)29-17-7-2-8-18-29/h1,3-6,9-16,19H,2,7-8,17-18H2,(H,28,30)/b24-19+ |
| InChIKey | FCDRZFQPNAXYPF-LYBHJNIJSA-N |
| XLogP | 5.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.02 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|