C25H26N2O4S — CID 6505286
(E)-N-[4-(azepan-1-ylsulfonyl)phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide (PubChem CID 6505286) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is (E)-N-[4-(azepan-1-ylsulfonyl)phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-(azepan-1-ylsulfonyl)phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6505286 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (E)-N-[4-(azepan-1-ylsulfonyl)phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1)/C(=C/c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O4S/c28-25(24(19-22-11-8-18-31-22)20-9-4-3-5-10-20)26-21-12-14-23(15-13-21)32(29,30)27-16-6-1-2-7-17-27/h3-5,8-15,18-19H,1-2,6-7,16-17H2,(H,26,28)/b24-19+ |
| InChIKey | RTIBRYDJKWNUPH-LYBHJNIJSA-N |
| XLogP | 5.02 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|