C25H18Cl2N2O4S — CID 126190947
(E)-N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide (PubChem CID 126190947) has the molecular formula C25H18Cl2N2O4S and a molecular weight of 513.40 g/mol. Its IUPAC name is (E)-N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 126190947 |
| Molecular Formula | C25H18Cl2N2O4S |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | (E)-N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)cc1)/C(=C/c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C25H18Cl2N2O4S/c26-18-13-19(27)15-21(14-18)29-34(31,32)23-10-8-20(9-11-23)28-25(30)24(16-22-7-4-12-33-22)17-5-2-1-3-6-17/h1-16,29H,(H,28,30)/b24-16+ |
| InChIKey | ZQKGQFXRZZQCDC-LFVJCYFKSA-N |
| XLogP | 6.57 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|