C19H13Cl2NO2 — CID 21372266
(E)-N-(3,4-dichlorophenyl)-3-(furan-2-yl)-2-phenylprop-2-enamide (PubChem CID 21372266) has the molecular formula C19H13Cl2NO2 and a molecular weight of 358.22 g/mol. Its IUPAC name is (E)-N-(3,4-dichlorophenyl)-3-(furan-2-yl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-(3,4-dichlorophenyl)-3-(furan-2-yl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 21372266 |
| Molecular Formula | C19H13Cl2NO2 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | (E)-N-(3,4-dichlorophenyl)-3-(furan-2-yl)-2-phenylprop-2-enamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)/C(=C/c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C19H13Cl2NO2/c20-17-9-8-14(11-18(17)21)22-19(23)16(12-15-7-4-10-24-15)13-5-2-1-3-6-13/h1-12H,(H,22,23)/b16-12+ |
| InChIKey | RBNWMOCRKRRVRZ-FOWTUZBSSA-N |
| XLogP | 5.77 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|