C25H22N4O4S — CID 38018309
(E)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide (PubChem CID 38018309) has the molecular formula C25H22N4O4S and a molecular weight of 474.54 g/mol. Its IUPAC name is (E)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 38018309 |
| Molecular Formula | C25H22N4O4S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | (E)-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)/C(=C/c3ccco3)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C25H22N4O4S/c1-17-15-18(2)27-25(26-17)29-34(31,32)22-12-10-20(11-13-22)28-24(30)23(16-21-9-6-14-33-21)19-7-4-3-5-8-19/h3-16H,1-2H3,(H,28,30)(H,26,27,29)/b23-16+ |
| InChIKey | VKUUUOTUASQJEP-XQNSMLJCSA-N |
| XLogP | 4.67 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|