C26H21ClN2O4S — CID 126177677
(E)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide (PubChem CID 126177677) has the molecular formula C26H21ClN2O4S and a molecular weight of 492.98 g/mol. Its IUPAC name is (E)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 126177677 |
| Molecular Formula | C26H21ClN2O4S |
| Molecular Weight | 492.98 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | (E)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-3-(furan-2-yl)-2-phenylprop-2-enamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)/C(=C/c3ccco3)c3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C26H21ClN2O4S/c1-18-9-10-21(16-25(18)27)29-34(31,32)23-13-11-20(12-14-23)28-26(30)24(17-22-8-5-15-33-22)19-6-3-2-4-7-19/h2-17,29H,1H3,(H,28,30)/b24-17+ |
| InChIKey | ANNORKIAJSADKD-JJIBRWJFSA-N |
| XLogP | 6.22 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.98 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|