C22H17Cl3N2O3S — CID 126186388
(E)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 126186388) has the molecular formula C22H17Cl3N2O3S and a molecular weight of 495.82 g/mol. Its IUPAC name is (E)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126186388 |
| Molecular Formula | C22H17Cl3N2O3S |
| Molecular Weight | 495.82 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | (E)-N-[4-[(3-chloro-4-methylphenyl)sulfamoyl]phenyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)/C=C/c3ccc(Cl)cc3Cl)cc2)cc1Cl |
| InChI | InChI=1S/C22H17Cl3N2O3S/c1-14-2-6-18(13-20(14)24)27-31(29,30)19-9-7-17(8-10-19)26-22(28)11-4-15-3-5-16(23)12-21(15)25/h2-13,27H,1H3,(H,26,28)/b11-4+ |
| InChIKey | PIXGJXJSFUAULW-NYYWCZLTSA-N |
| XLogP | 6.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.82 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|