C22H18Cl2N2O3S — CID 3708670
3-(2,4-dichlorophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]prop-2-enamide (PubChem CID 3708670) has the molecular formula C22H18Cl2N2O3S and a molecular weight of 461.37 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]prop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3708670 |
| Molecular Formula | C22H18Cl2N2O3S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[4-[(4-methylphenyl)sulfonylamino]phenyl]prop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NC(=O)C=Cc3ccc(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O3S/c1-15-2-11-20(12-3-15)30(28,29)26-19-9-7-18(8-10-19)25-22(27)13-5-16-4-6-17(23)14-21(16)24/h2-14,26H,1H3,(H,25,27) |
| InChIKey | CNFZPKURCUYVEC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|