C17H16Cl2N2O3S — CID 9107077
(E)-3-(2,4-dichlorophenyl)-N-[4-methyl-3-(methylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 9107077) has the molecular formula C17H16Cl2N2O3S and a molecular weight of 399.30 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[4-methyl-3-(methylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[4-methyl-3-(methylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 9107077 |
| Molecular Formula | C17H16Cl2N2O3S |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[4-methyl-3-(methylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)/C=C/c2ccc(Cl)cc2Cl)ccc1C |
| InChI | InChI=1S/C17H16Cl2N2O3S/c1-11-3-7-14(10-16(11)25(23,24)20-2)21-17(22)8-5-12-4-6-13(18)9-15(12)19/h3-10,20H,1-2H3,(H,21,22)/b8-5+ |
| InChIKey | BNSIJHGWKMYTSM-VMPITWQZSA-N |
| XLogP | 3.86 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|