C24H23ClN2O6S — CID 3559245
N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2,3,4-trimethoxyphenyl)prop-2-enamide (PubChem CID 3559245) has the molecular formula C24H23ClN2O6S and a molecular weight of 502.98 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2,3,4-trimethoxyphenyl)prop-2-enamide.
| Compound Name | N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2,3,4-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3559245 |
| Molecular Formula | C24H23ClN2O6S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2,3,4-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)cc3)cc2)c(OC)c1OC |
| InChI | InChI=1S/C24H23ClN2O6S/c1-31-21-14-4-16(23(32-2)24(21)33-3)5-15-22(28)26-18-10-12-20(13-11-18)34(29,30)27-19-8-6-17(25)7-9-19/h4-15,27H,1-3H3,(H,26,28) |
| InChIKey | FQTRGLCOTAIZNT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|