C18H17ClINO4 — CID 22301745
(Z)-N-(3-chloro-4-iodophenyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide (PubChem CID 22301745) has the molecular formula C18H17ClINO4 and a molecular weight of 473.69 g/mol. Its IUPAC name is (Z)-N-(3-chloro-4-iodophenyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-N-(3-chloro-4-iodophenyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 22301745 |
| Molecular Formula | C18H17ClINO4 |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | (Z)-N-(3-chloro-4-iodophenyl)-3-(2,3,4-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C\C(=O)Nc2ccc(I)c(Cl)c2)c(OC)c1OC |
| InChI | InChI=1S/C18H17ClINO4/c1-23-15-8-4-11(17(24-2)18(15)25-3)5-9-16(22)21-12-6-7-14(20)13(19)10-12/h4-10H,1-3H3,(H,21,22)/b9-5- |
| InChIKey | COJULQHSSHTMTE-UITAMQMPSA-N |
| XLogP | 4.62 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|