C17H14Br2ClNO3 — CID 1116383
N-(3-chloro-4-methoxyphenyl)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide (PubChem CID 1116383) has the molecular formula C17H14Br2ClNO3 and a molecular weight of 475.56 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1116383 |
| Molecular Formula | C17H14Br2ClNO3 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 472.90 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)C=Cc2cc(Br)cc(Br)c2OC)cc1Cl |
| InChI | InChI=1S/C17H14Br2ClNO3/c1-23-15-5-4-12(9-14(15)20)21-16(22)6-3-10-7-11(18)8-13(19)17(10)24-2/h3-9H,1-2H3,(H,21,22) |
| InChIKey | AKBQROXGFMQGRG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|