C27H25Br2Cl2N3O2 — CID 3944029
N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide (PubChem CID 3944029) has the molecular formula C27H25Br2Cl2N3O2 and a molecular weight of 654.23 g/mol. Its IUPAC name is N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3944029 |
| Molecular Formula | C27H25Br2Cl2N3O2 |
| Molecular Weight | 654.23 g/mol |
| Exact Mass | 650.97 |
| IUPAC Name | N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1c(Br)cc(Br)cc1C=CC(=O)Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)c(Cl)c1 |
| InChI | InChI=1S/C27H25Br2Cl2N3O2/c1-36-27-18(14-20(28)15-22(27)29)6-9-26(35)32-21-7-8-25(24(31)16-21)34-12-10-33(11-13-34)17-19-4-2-3-5-23(19)30/h2-9,14-16H,10-13,17H2,1H3,(H,32,35) |
| InChIKey | BBDKFCVJFADBGF-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.23 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|