C21H23Br2N3O4S — CID 3498943
3-(3,5-dibromo-2-methoxyphenyl)-N-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 3498943) has the molecular formula C21H23Br2N3O4S and a molecular weight of 573.31 g/mol. Its IUPAC name is 3-(3,5-dibromo-2-methoxyphenyl)-N-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | 3-(3,5-dibromo-2-methoxyphenyl)-N-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3498943 |
| Molecular Formula | C21H23Br2N3O4S |
| Molecular Weight | 573.31 g/mol |
| Exact Mass | 570.98 |
| IUPAC Name | 3-(3,5-dibromo-2-methoxyphenyl)-N-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | COc1c(Br)cc(Br)cc1C=CC(=O)Nc1ccccc1N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C21H23Br2N3O4S/c1-30-21-15(13-16(22)14-17(21)23)7-8-20(27)24-18-5-3-4-6-19(18)25-9-11-26(12-10-25)31(2,28)29/h3-8,13-14H,9-12H2,1-2H3,(H,24,27) |
| InChIKey | GPGGGJDMLBSNKR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|