C19H21BrN4O3S2 — CID 3363390
4-bromo-N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3363390) has the molecular formula C19H21BrN4O3S2 and a molecular weight of 497.44 g/mol. Its IUPAC name is 4-bromo-N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-bromo-N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3363390 |
| Molecular Formula | C19H21BrN4O3S2 |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | 4-bromo-N-[[2-(4-methylsulfonylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CS(=O)(=O)N1CCN(c2ccccc2NC(=S)NC(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H21BrN4O3S2/c1-29(26,27)24-12-10-23(11-13-24)17-5-3-2-4-16(17)21-19(28)22-18(25)14-6-8-15(20)9-7-14/h2-9H,10-13H2,1H3,(H2,21,22,25,28) |
| InChIKey | MXHXCABUDWUZMB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|