C20H21BrN4O2S — CID 17110048
N-[[2-(4-acetylpiperazin-1-yl)phenyl]carbamothioyl]-4-bromobenzamide (PubChem CID 17110048) has the molecular formula C20H21BrN4O2S and a molecular weight of 461.39 g/mol. Its IUPAC name is N-[[2-(4-acetylpiperazin-1-yl)phenyl]carbamothioyl]-4-bromobenzamide.
| Compound Name | N-[[2-(4-acetylpiperazin-1-yl)phenyl]carbamothioyl]-4-bromobenzamide |
|---|---|
| PubChem CID | 17110048 |
| Molecular Formula | C20H21BrN4O2S |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | N-[[2-(4-acetylpiperazin-1-yl)phenyl]carbamothioyl]-4-bromobenzamide |
| SMILES | CC(=O)N1CCN(c2ccccc2NC(=S)NC(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H21BrN4O2S/c1-14(26)24-10-12-25(13-11-24)18-5-3-2-4-17(18)22-20(28)23-19(27)15-6-8-16(21)9-7-15/h2-9H,10-13H2,1H3,(H2,22,23,27,28) |
| InChIKey | BLAMFPZAJJXQDP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|