C18H18IN3OS — CID 4502371
4-iodo-N-[(2-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide (PubChem CID 4502371) has the molecular formula C18H18IN3OS and a molecular weight of 451.33 g/mol. Its IUPAC name is 4-iodo-N-[(2-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide.
| Compound Name | 4-iodo-N-[(2-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4502371 |
| Molecular Formula | C18H18IN3OS |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 4-iodo-N-[(2-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1N1CCCC1)c1ccc(I)cc1 |
| InChI | InChI=1S/C18H18IN3OS/c19-14-9-7-13(8-10-14)17(23)21-18(24)20-15-5-1-2-6-16(15)22-11-3-4-12-22/h1-2,5-10H,3-4,11-12H2,(H2,20,21,23,24) |
| InChIKey | QUOHQJDDRGJGEQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|