C18H17Br2NO2 — CID 3632824
3-(3,5-dibromo-2-methoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide (PubChem CID 3632824) has the molecular formula C18H17Br2NO2 and a molecular weight of 439.15 g/mol. Its IUPAC name is 3-(3,5-dibromo-2-methoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide.
| Compound Name | 3-(3,5-dibromo-2-methoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3632824 |
| Molecular Formula | C18H17Br2NO2 |
| Molecular Weight | 439.15 g/mol |
| Exact Mass | 436.96 |
| IUPAC Name | 3-(3,5-dibromo-2-methoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide |
| SMILES | COc1c(Br)cc(Br)cc1C=CC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C18H17Br2NO2/c1-11-4-5-12(2)16(8-11)21-17(22)7-6-13-9-14(19)10-15(20)18(13)23-3/h4-10H,1-3H3,(H,21,22) |
| InChIKey | LKAZIUYMUDTVEM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.15 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|