C15H12Br2N2O3S — CID 3315853
N'-[3-(3,5-dibromo-2-methoxyphenyl)prop-2-enoyl]thiophene-2-carbohydrazide (PubChem CID 3315853) has the molecular formula C15H12Br2N2O3S and a molecular weight of 460.15 g/mol. Its IUPAC name is N'-[3-(3,5-dibromo-2-methoxyphenyl)prop-2-enoyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[3-(3,5-dibromo-2-methoxyphenyl)prop-2-enoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 3315853 |
| Molecular Formula | C15H12Br2N2O3S |
| Molecular Weight | 460.15 g/mol |
| Exact Mass | 457.89 |
| IUPAC Name | N'-[3-(3,5-dibromo-2-methoxyphenyl)prop-2-enoyl]thiophene-2-carbohydrazide |
| SMILES | COc1c(Br)cc(Br)cc1C=CC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C15H12Br2N2O3S/c1-22-14-9(7-10(16)8-11(14)17)4-5-13(20)18-19-15(21)12-3-2-6-23-12/h2-8H,1H3,(H,18,20)(H,19,21) |
| InChIKey | IKPDRIWNIAZVDT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.15 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|