C16H17BrN2O4S — CID 9479373
N'-(3-bromo-5-methoxy-4-propoxybenzoyl)thiophene-2-carbohydrazide (PubChem CID 9479373) has the molecular formula C16H17BrN2O4S and a molecular weight of 413.29 g/mol. Its IUPAC name is N'-(3-bromo-5-methoxy-4-propoxybenzoyl)thiophene-2-carbohydrazide.
| Compound Name | N'-(3-bromo-5-methoxy-4-propoxybenzoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9479373 |
| Molecular Formula | C16H17BrN2O4S |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | N'-(3-bromo-5-methoxy-4-propoxybenzoyl)thiophene-2-carbohydrazide |
| SMILES | CCCOc1c(Br)cc(C(=O)NNC(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C16H17BrN2O4S/c1-3-6-23-14-11(17)8-10(9-12(14)22-2)15(20)18-19-16(21)13-5-4-7-24-13/h4-5,7-9H,3,6H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | QWVQHKKZKWUFTL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|