C20H21BrN2O6 — CID 35794749
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-bromo-5-methoxy-4-propoxybenzoate (PubChem CID 35794749) has the molecular formula C20H21BrN2O6 and a molecular weight of 465.30 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-bromo-5-methoxy-4-propoxybenzoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-bromo-5-methoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 35794749 |
| Molecular Formula | C20H21BrN2O6 |
| Molecular Weight | 465.30 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-bromo-5-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1c(Br)cc(C(=O)OCC(=O)NNC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H21BrN2O6/c1-3-9-28-18-15(21)10-14(11-16(18)27-2)20(26)29-12-17(24)22-23-19(25)13-7-5-4-6-8-13/h4-8,10-11H,3,9,12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | OOXOQVCXGIKNQN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|