C18H20BrNO5S — CID 29183723
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-bromo-5-methoxy-4-propoxybenzoate (PubChem CID 29183723) has the molecular formula C18H20BrNO5S and a molecular weight of 442.33 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-bromo-5-methoxy-4-propoxybenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-bromo-5-methoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 29183723 |
| Molecular Formula | C18H20BrNO5S |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-bromo-5-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1c(Br)cc(C(=O)OCC(=O)NCc2cccs2)cc1OC |
| InChI | InChI=1S/C18H20BrNO5S/c1-3-6-24-17-14(19)8-12(9-15(17)23-2)18(22)25-11-16(21)20-10-13-5-4-7-26-13/h4-5,7-9H,3,6,10-11H2,1-2H3,(H,20,21) |
| InChIKey | KLWHMVNCUAMSPL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |