C18H15Br3N2O3S — CID 5090207
N-[(3-bromo-4-methoxyphenyl)carbamothioyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide (PubChem CID 5090207) has the molecular formula C18H15Br3N2O3S and a molecular weight of 579.11 g/mol. Its IUPAC name is N-[(3-bromo-4-methoxyphenyl)carbamothioyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[(3-bromo-4-methoxyphenyl)carbamothioyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5090207 |
| Molecular Formula | C18H15Br3N2O3S |
| Molecular Weight | 579.11 g/mol |
| Exact Mass | 575.84 |
| IUPAC Name | N-[(3-bromo-4-methoxyphenyl)carbamothioyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=S)NC(=O)C=Cc2cc(Br)cc(Br)c2OC)cc1Br |
| InChI | InChI=1S/C18H15Br3N2O3S/c1-25-15-5-4-12(9-13(15)20)22-18(27)23-16(24)6-3-10-7-11(19)8-14(21)17(10)26-2/h3-9H,1-2H3,(H2,22,23,24,27) |
| InChIKey | ZYPWWHVAYQTTLC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.11 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|