C28H25Br2N3O3S — CID 6123799
(E)-N-[[3-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide (PubChem CID 6123799) has the molecular formula C28H25Br2N3O3S and a molecular weight of 643.40 g/mol. Its IUPAC name is (E)-N-[[3-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[3-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6123799 |
| Molecular Formula | C28H25Br2N3O3S |
| Molecular Weight | 643.40 g/mol |
| Exact Mass | 641.00 |
| IUPAC Name | (E)-N-[[3-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
| SMILES | CCC(C)c1ccc2oc(-c3cccc(NC(=S)NC(=O)/C=C/c4cc(Br)cc(Br)c4OC)c3)nc2c1 |
| InChI | InChI=1S/C28H25Br2N3O3S/c1-4-16(2)17-8-10-24-23(14-17)32-27(36-24)19-6-5-7-21(13-19)31-28(37)33-25(34)11-9-18-12-20(29)15-22(30)26(18)35-3/h5-16H,4H2,1-3H3,(H2,31,33,34,37)/b11-9+ |
| InChIKey | ZOBRTYDGSLMZOL-PKNBQFBNSA-N |
| XLogP | 8.07 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.40 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|