C15H16Br2N6O2S — CID 4501921
3-(3,5-dibromo-2-methoxyphenyl)-N-[(1-propyltetrazol-5-yl)carbamothioyl]prop-2-enamide (PubChem CID 4501921) has the molecular formula C15H16Br2N6O2S and a molecular weight of 504.21 g/mol. Its IUPAC name is 3-(3,5-dibromo-2-methoxyphenyl)-N-[(1-propyltetrazol-5-yl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-(3,5-dibromo-2-methoxyphenyl)-N-[(1-propyltetrazol-5-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4501921 |
| Molecular Formula | C15H16Br2N6O2S |
| Molecular Weight | 504.21 g/mol |
| Exact Mass | 501.94 |
| IUPAC Name | 3-(3,5-dibromo-2-methoxyphenyl)-N-[(1-propyltetrazol-5-yl)carbamothioyl]prop-2-enamide |
| SMILES | CCCn1nnnc1NC(=S)NC(=O)C=Cc1cc(Br)cc(Br)c1OC |
| InChI | InChI=1S/C15H16Br2N6O2S/c1-3-6-23-14(20-21-22-23)19-15(26)18-12(24)5-4-9-7-10(16)8-11(17)13(9)25-2/h4-5,7-8H,3,6H2,1-2H3,(H2,18,19,20,22,24,26) |
| InChIKey | LWLUHSHCGSVJPB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|