C12H13ClN6OS — CID 960258
2-chloro-N-[(1-propyltetrazol-5-yl)carbamothioyl]benzamide (PubChem CID 960258) has the molecular formula C12H13ClN6OS and a molecular weight of 324.80 g/mol. Its IUPAC name is 2-chloro-N-[(1-propyltetrazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 2-chloro-N-[(1-propyltetrazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 960258 |
| Molecular Formula | C12H13ClN6OS |
| Molecular Weight | 324.80 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-chloro-N-[(1-propyltetrazol-5-yl)carbamothioyl]benzamide |
| SMILES | CCCn1nnnc1NC(=S)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C12H13ClN6OS/c1-2-7-19-11(16-17-18-19)15-12(21)14-10(20)8-5-3-4-6-9(8)13/h3-6H,2,7H2,1H3,(H2,14,15,16,18,20,21) |
| InChIKey | LFEJXBWEMMPZKD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.80 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|