C16H22N6O2S — CID 40616842
4-[(2S)-butan-2-yl]oxy-N-[(1-propyltetrazol-5-yl)carbamothioyl]benzamide (PubChem CID 40616842) has the molecular formula C16H22N6O2S and a molecular weight of 362.46 g/mol. Its IUPAC name is 4-[(2S)-butan-2-yl]oxy-N-[(1-propyltetrazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 4-[(2S)-butan-2-yl]oxy-N-[(1-propyltetrazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 40616842 |
| Molecular Formula | C16H22N6O2S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[(2S)-butan-2-yl]oxy-N-[(1-propyltetrazol-5-yl)carbamothioyl]benzamide |
| SMILES | CCCn1nnnc1NC(=S)NC(=O)c1ccc(O[C@@H](C)CC)cc1 |
| InChI | InChI=1S/C16H22N6O2S/c1-4-10-22-15(19-20-21-22)18-16(25)17-14(23)12-6-8-13(9-7-12)24-11(3)5-2/h6-9,11H,4-5,10H2,1-3H3,(H2,17,18,19,21,23,25)/t11-/m0/s1 |
| InChIKey | RSFDBTJJIAKORA-NSHDSACASA-N |
| XLogP | 2.39 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|