C27H26BrCl2N3O2 — CID 5169661
3-(5-bromo-2-methoxyphenyl)-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]prop-2-enamide (PubChem CID 5169661) has the molecular formula C27H26BrCl2N3O2 and a molecular weight of 575.33 g/mol. Its IUPAC name is 3-(5-bromo-2-methoxyphenyl)-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]prop-2-enamide.
| Compound Name | 3-(5-bromo-2-methoxyphenyl)-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5169661 |
| Molecular Formula | C27H26BrCl2N3O2 |
| Molecular Weight | 575.33 g/mol |
| Exact Mass | 573.06 |
| IUPAC Name | 3-(5-bromo-2-methoxyphenyl)-N-[3-chloro-4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(Br)cc1C=CC(=O)Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)c(Cl)c1 |
| InChI | InChI=1S/C27H26BrCl2N3O2/c1-35-26-10-7-21(28)16-19(26)6-11-27(34)31-22-8-9-25(24(30)17-22)33-14-12-32(13-15-33)18-20-4-2-3-5-23(20)29/h2-11,16-17H,12-15,18H2,1H3,(H,31,34) |
| InChIKey | NMSLKHIOBZHOCI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.33 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|