C24H24N2O4S — CID 3982456
N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 3982456) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3982456 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1C=CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-17-8-10-21(16-18(17)2)26-31(28,29)22-13-11-20(12-14-22)25-24(27)15-9-19-6-4-5-7-23(19)30-3/h4-16,26H,1-3H3,(H,25,27) |
| InChIKey | BPWSNHTYCUTIMT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|