C24H21Cl2NO6S — CID 122188435
2,5-dichloro-N-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenyl]benzenesulfonamide (PubChem CID 122188435) has the molecular formula C24H21Cl2NO6S and a molecular weight of 522.41 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122188435 |
| Molecular Formula | C24H21Cl2NO6S |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | 2,5-dichloro-N-[4-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]phenyl]benzenesulfonamide |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(NS(=O)(=O)c3cc(Cl)ccc3Cl)cc2)c(OC)c1OC |
| InChI | InChI=1S/C24H21Cl2NO6S/c1-31-21-13-7-16(23(32-2)24(21)33-3)6-12-20(28)15-4-9-18(10-5-15)27-34(29,30)22-14-17(25)8-11-19(22)26/h4-14,27H,1-3H3/b12-6+ |
| InChIKey | CVJOIBIAYDRFPV-WUXMJOGZSA-N |
| XLogP | 5.72 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|