C15H15Cl2NO5S — CID 2988024
2,5-dichloro-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide (PubChem CID 2988024) has the molecular formula C15H15Cl2NO5S and a molecular weight of 392.26 g/mol. Its IUPAC name is 2,5-dichloro-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2988024 |
| Molecular Formula | C15H15Cl2NO5S |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 2,5-dichloro-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cc(Cl)ccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C15H15Cl2NO5S/c1-21-12-7-10(8-13(22-2)15(12)23-3)18-24(19,20)14-6-9(16)4-5-11(14)17/h4-8,18H,1-3H3 |
| InChIKey | AIQVOQITQLJYQN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |