C17H20Cl2N2O4S — CID 57437853
5-chloro-N-[4-chloro-3-[2-(dimethylamino)ethoxy]phenyl]-2-methoxybenzenesulfonamide (PubChem CID 57437853) has the molecular formula C17H20Cl2N2O4S and a molecular weight of 419.33 g/mol. Its IUPAC name is 5-chloro-N-[4-chloro-3-[2-(dimethylamino)ethoxy]phenyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-N-[4-chloro-3-[2-(dimethylamino)ethoxy]phenyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 57437853 |
| Molecular Formula | C17H20Cl2N2O4S |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 5-chloro-N-[4-chloro-3-[2-(dimethylamino)ethoxy]phenyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)Nc1ccc(Cl)c(OCCN(C)C)c1 |
| InChI | InChI=1S/C17H20Cl2N2O4S/c1-21(2)8-9-25-16-11-13(5-6-14(16)19)20-26(22,23)17-10-12(18)4-7-15(17)24-3/h4-7,10-11,20H,8-9H2,1-3H3 |
| InChIKey | RTAVHTFKAHOBAO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |