C17H20Cl2N2O3S — CID 10222792
3-chloro-N-[4-chloro-3-[2-(dimethylamino)ethoxy]phenyl]-4-methylbenzenesulfonamide (PubChem CID 10222792) has the molecular formula C17H20Cl2N2O3S and a molecular weight of 403.33 g/mol. Its IUPAC name is 3-chloro-N-[4-chloro-3-[2-(dimethylamino)ethoxy]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-chloro-N-[4-chloro-3-[2-(dimethylamino)ethoxy]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10222792 |
| Molecular Formula | C17H20Cl2N2O3S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 3-chloro-N-[4-chloro-3-[2-(dimethylamino)ethoxy]phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Cl)c(OCCN(C)C)c2)cc1Cl |
| InChI | InChI=1S/C17H20Cl2N2O3S/c1-12-4-6-14(11-16(12)19)25(22,23)20-13-5-7-15(18)17(10-13)24-9-8-21(2)3/h4-7,10-11,20H,8-9H2,1-3H3 |
| InChIKey | KODQFFPVWNXLEN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |