C16H18I2N2O3S — CID 10188202
N-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-4-iodobenzenesulfonamide (PubChem CID 10188202) has the molecular formula C16H18I2N2O3S and a molecular weight of 572.21 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-4-iodobenzenesulfonamide.
| Compound Name | N-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 10188202 |
| Molecular Formula | C16H18I2N2O3S |
| Molecular Weight | 572.21 g/mol |
| Exact Mass | 571.91 |
| IUPAC Name | N-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-4-iodobenzenesulfonamide |
| SMILES | CN(C)CCOc1cc(NS(=O)(=O)c2ccc(I)cc2)ccc1I |
| InChI | InChI=1S/C16H18I2N2O3S/c1-20(2)9-10-23-16-11-13(5-8-15(16)18)19-24(21,22)14-6-3-12(17)4-7-14/h3-8,11,19H,9-10H2,1-2H3 |
| InChIKey | AYVRBOCLRMPBBI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|