C19H24IN3O2 — CID 54111043
1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(3-ethylphenyl)urea (PubChem CID 54111043) has the molecular formula C19H24IN3O2 and a molecular weight of 453.32 g/mol. Its IUPAC name is 1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(3-ethylphenyl)urea.
| Compound Name | 1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(3-ethylphenyl)urea |
|---|---|
| PubChem CID | 54111043 |
| Molecular Formula | C19H24IN3O2 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(3-ethylphenyl)urea |
| SMILES | CCc1cccc(NC(=O)Nc2ccc(I)c(OCCN(C)C)c2)c1 |
| InChI | InChI=1S/C19H24IN3O2/c1-4-14-6-5-7-15(12-14)21-19(24)22-16-8-9-17(20)18(13-16)25-11-10-23(2)3/h5-9,12-13H,4,10-11H2,1-3H3,(H2,21,22,24) |
| InChIKey | NHCDUAUKKIYWFE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|