C38H46I2N6O4 — CID 57067992
1-[3-[2-(dimethylamino)ethoxy]-N-[(2,3-dimethylphenyl)carbamoyl]-4-iodoanilino]-1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(3-ethylphenyl)urea (PubChem CID 57067992) has the molecular formula C38H46I2N6O4 and a molecular weight of 904.63 g/mol. Its IUPAC name is 1-[3-[2-(dimethylamino)ethoxy]-N-[(2,3-dimethylphenyl)carbamoyl]-4-iodoanilino]-1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(3-ethylphenyl)urea.
| Compound Name | 1-[3-[2-(dimethylamino)ethoxy]-N-[(2,3-dimethylphenyl)carbamoyl]-4-iodoanilino]-1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(3-ethylphenyl)urea |
|---|---|
| PubChem CID | 57067992 |
| Molecular Formula | C38H46I2N6O4 |
| Molecular Weight | 904.63 g/mol |
| Exact Mass | 904.17 |
| IUPAC Name | 1-[3-[2-(dimethylamino)ethoxy]-N-[(2,3-dimethylphenyl)carbamoyl]-4-iodoanilino]-1-[3-[2-(dimethylamino)ethoxy]-4-iodophenyl]-3-(3-ethylphenyl)urea |
| SMILES | CCc1cccc(NC(=O)N(c2ccc(I)c(OCCN(C)C)c2)N(C(=O)Nc2cccc(C)c2C)c2ccc(I)c(OCCN(C)C)c2)c1 |
| InChI | InChI=1S/C38H46I2N6O4/c1-8-28-12-10-13-29(23-28)41-37(47)45(30-15-17-32(39)35(24-30)49-21-19-43(4)5)46(38(48)42-34-14-9-11-26(2)27(34)3)31-16-18-33(40)36(25-31)50-22-20-44(6)7/h9-18,23-25H,8,19-22H2,1-7H3,(H,41,47)(H,42,48) |
| InChIKey | VOCCPMJEJYLPCP-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.63 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|