C29H25ClN2O3S — CID 28589712
(E)-3-(2-chlorophenyl)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-2-phenylprop-2-enamide (PubChem CID 28589712) has the molecular formula C29H25ClN2O3S and a molecular weight of 517.05 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 28589712 |
| Molecular Formula | C29H25ClN2O3S |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-2-phenylprop-2-enamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(NC(=O)/C(=C/c2ccccc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25ClN2O3S/c1-20-9-8-10-21(2)28(20)32-36(34,35)25-17-15-24(16-18-25)31-29(33)26(22-11-4-3-5-12-22)19-23-13-6-7-14-27(23)30/h3-19,32H,1-2H3,(H,31,33)/b26-19+ |
| InChIKey | XIUIAXFDYULHNM-LGUFXXKBSA-N |
| XLogP | 6.94 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|