C25H24ClNO — CID 126140872
(E)-3-(2-chlorophenyl)-N-(2,6-diethylphenyl)-2-phenylprop-2-enamide (PubChem CID 126140872) has the molecular formula C25H24ClNO and a molecular weight of 389.93 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(2,6-diethylphenyl)-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(2,6-diethylphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 126140872 |
| Molecular Formula | C25H24ClNO |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(2,6-diethylphenyl)-2-phenylprop-2-enamide |
| SMILES | CCc1cccc(CC)c1NC(=O)/C(=C/c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C25H24ClNO/c1-3-18-14-10-15-19(4-2)24(18)27-25(28)22(20-11-6-5-7-12-20)17-21-13-8-9-16-23(21)26/h5-17H,3-4H2,1-2H3,(H,27,28)/b22-17+ |
| InChIKey | WGRFDQDQCNJGJY-OQKWZONESA-N |
| XLogP | 6.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|