C22H16Cl3NO — CID 4191533
3-(2-chlorophenyl)-N-[(2,4-dichlorophenyl)methyl]-2-phenylprop-2-enamide (PubChem CID 4191533) has the molecular formula C22H16Cl3NO and a molecular weight of 416.74 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[(2,4-dichlorophenyl)methyl]-2-phenylprop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[(2,4-dichlorophenyl)methyl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4191533 |
| Molecular Formula | C22H16Cl3NO |
| Molecular Weight | 416.74 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[(2,4-dichlorophenyl)methyl]-2-phenylprop-2-enamide |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)C(=Cc1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C22H16Cl3NO/c23-18-11-10-17(21(25)13-18)14-26-22(27)19(15-6-2-1-3-7-15)12-16-8-4-5-9-20(16)24/h1-13H,14H2,(H,26,27) |
| InChIKey | MKZGYRJVSYMCLK-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.74 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|