C14H10BrCl2NO — CID 87870430
N-bromo-N-[(2,4-dichlorophenyl)methyl]benzamide (PubChem CID 87870430) has the molecular formula C14H10BrCl2NO and a molecular weight of 359.05 g/mol. Its IUPAC name is N-bromo-N-[(2,4-dichlorophenyl)methyl]benzamide.
| Compound Name | N-bromo-N-[(2,4-dichlorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 87870430 |
| Molecular Formula | C14H10BrCl2NO |
| Molecular Weight | 359.05 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | N-bromo-N-[(2,4-dichlorophenyl)methyl]benzamide |
| SMILES | O=C(c1ccccc1)N(Br)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10BrCl2NO/c15-18(14(19)10-4-2-1-3-5-10)9-11-6-7-12(16)8-13(11)17/h1-8H,9H2 |
| InChIKey | IUKJTCZIHOKBAY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.05 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|