C14H9Cl4NO — CID 87870486
N-chloro-N-[(2,4,6-trichlorophenyl)methyl]benzamide (PubChem CID 87870486) has the molecular formula C14H9Cl4NO and a molecular weight of 349.04 g/mol. Its IUPAC name is N-chloro-N-[(2,4,6-trichlorophenyl)methyl]benzamide.
| Compound Name | N-chloro-N-[(2,4,6-trichlorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 87870486 |
| Molecular Formula | C14H9Cl4NO |
| Molecular Weight | 349.04 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | N-chloro-N-[(2,4,6-trichlorophenyl)methyl]benzamide |
| SMILES | O=C(c1ccccc1)N(Cl)Cc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl4NO/c15-10-6-12(16)11(13(17)7-10)8-19(18)14(20)9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | CBHGNZIWFMDHBS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.04 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|