C25H17Cl2NO3 — CID 71283525
4-[benzoyl(benzyl)amino]-5,7-dichloronaphthalene-2-carboxylic acid (PubChem CID 71283525) has the molecular formula C25H17Cl2NO3 and a molecular weight of 450.32 g/mol. Its IUPAC name is 4-[benzoyl(benzyl)amino]-5,7-dichloronaphthalene-2-carboxylic acid.
| Compound Name | 4-[benzoyl(benzyl)amino]-5,7-dichloronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 71283525 |
| Molecular Formula | C25H17Cl2NO3 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 4-[benzoyl(benzyl)amino]-5,7-dichloronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(N(Cc2ccccc2)C(=O)c2ccccc2)c2c(Cl)cc(Cl)cc2c1 |
| InChI | InChI=1S/C25H17Cl2NO3/c26-20-12-18-11-19(25(30)31)13-22(23(18)21(27)14-20)28(15-16-7-3-1-4-8-16)24(29)17-9-5-2-6-10-17/h1-14H,15H2,(H,30,31) |
| InChIKey | PSNRTOYVUAMRRN-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |