C21H14Cl2N2O4 — CID 87415811
5,7-dichloro-4-[2-[N-(cyanomethyl)anilino]-2-oxoethoxy]naphthalene-2-carboxylic acid (PubChem CID 87415811) has the molecular formula C21H14Cl2N2O4 and a molecular weight of 429.26 g/mol. Its IUPAC name is 5,7-dichloro-4-[2-[N-(cyanomethyl)anilino]-2-oxoethoxy]naphthalene-2-carboxylic acid.
| Compound Name | 5,7-dichloro-4-[2-[N-(cyanomethyl)anilino]-2-oxoethoxy]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 87415811 |
| Molecular Formula | C21H14Cl2N2O4 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 5,7-dichloro-4-[2-[N-(cyanomethyl)anilino]-2-oxoethoxy]naphthalene-2-carboxylic acid |
| SMILES | N#CCN(C(=O)COc1cc(C(=O)O)cc2cc(Cl)cc(Cl)c12)c1ccccc1 |
| InChI | InChI=1S/C21H14Cl2N2O4/c22-15-9-13-8-14(21(27)28)10-18(20(13)17(23)11-15)29-12-19(26)25(7-6-24)16-4-2-1-3-5-16/h1-5,8-11H,7,12H2,(H,27,28) |
| InChIKey | AYGMSWJXROMUFE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|