C22H18Cl2N2O7 — CID 87415849
4-[2-[4-(aminomethyl)-N-(carboxymethoxy)anilino]-2-oxoethoxy]-5,7-dichloronaphthalene-2-carboxylic acid (PubChem CID 87415849) has the molecular formula C22H18Cl2N2O7 and a molecular weight of 493.30 g/mol. Its IUPAC name is 4-[2-[4-(aminomethyl)-N-(carboxymethoxy)anilino]-2-oxoethoxy]-5,7-dichloronaphthalene-2-carboxylic acid.
| Compound Name | 4-[2-[4-(aminomethyl)-N-(carboxymethoxy)anilino]-2-oxoethoxy]-5,7-dichloronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 87415849 |
| Molecular Formula | C22H18Cl2N2O7 |
| Molecular Weight | 493.30 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 4-[2-[4-(aminomethyl)-N-(carboxymethoxy)anilino]-2-oxoethoxy]-5,7-dichloronaphthalene-2-carboxylic acid |
| SMILES | NCc1ccc(N(OCC(=O)O)C(=O)COc2cc(C(=O)O)cc3cc(Cl)cc(Cl)c23)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O7/c23-15-6-13-5-14(22(30)31)7-18(21(13)17(24)8-15)32-10-19(27)26(33-11-20(28)29)16-3-1-12(9-25)2-4-16/h1-8H,9-11,25H2,(H,28,29)(H,30,31) |
| InChIKey | YZKRVJOBSZWCFX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|